Redigerer Temazepam

{{uoversatt}}

{{Drugbox 
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 419678897
| IUPAC_name = 7-Chloro-1,3-dihydro-3-hydroxy-1-methyl-5-phenyl-1,4-benzodiazepin-2-one
| image = Temazepam.svg
| width = 218
| image2 = Temazepam-3D-ball-model.png
| width2 = 189
<!--Clinical data-->
| tradename = Restoril, Normison, Nortem, others
| Drugs.com = {{drugs.com|monograph|temazepam}}
| MedlinePlus = a684003
| pregnancy_AU = C
| pregnancy_US = X
| legal_AU = S4D (Prescription only with additional restrictions)
| legal_CA = Schedule IV
| legal_DE = Rx-only/Anlage III
| legal_UK = Class C POM (CD)
<!-- | legal_Irl = Schedule 3 -->
| legal_UK_comment = {{clarify|date=October 2015}}
| legal_US = Schedule IV
| legal_UN = Psychotropic Schedule IV
| dependency_liability = High<ref>{{cite web |title=Temazepam |url=https://www.drugbank.ca/drugs/DB00231 |website=www.drugbank.ca |accessdate=26. juni 2019}}</ref>
| routes_of_administration = By mouth
<!--Pharmacokinetic data-->
| bioavailability = 96%
| metabolism = [[Liver]]
| elimination_half-life = 8–20 hours
| excretion = [[Kidney]]
<!--Identifiers-->
| IUPHAR_ligand = 7300
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 846-50-4
| ATC_prefix = N05
| ATC_suffix = CD07
| PubChem = 5391
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00231
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5198
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = CHB1QD2QSS
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00370
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 967
<!--Chemical data-->
| C=16 | H=13 | Cl=1 | N=2 | O=2
| molecular_weight = 300.7 g/mol
| smiles = CN1C2=C(C(C3=CC=CC=C3)=NC(O)C1=O)C=C(Cl)C=C2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H13ClN2O2/c1-19-13-8-7-11(17)9-12(13)14(18-15(20)16(19)21)10-5-3-2-4-6-10/h2-9,15,20H,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SEQDDYPDSLOBDC-UHFFFAOYSA-N
}}
<!-- Definition and medical uses -->
'''Temazepam''' som blir solgt under merkenavnet '''Restoril''' [[#Tilgjengelighet|blant annet]], er en medisin som brukes for å behandle folk som har problemer med [[insomnia|å sove]].<ref name=AHFS2019/> Generelt sett skal ikke medisinen benyttes i mer enn ti dager.<ref name=AHFS2019/> Den tas gjennom munnen.<ref name=AHFS2019>{{cite web |title=Temazepam Monograph for Professionals |url=https://www.drugs.com/monograph/temazepam.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |accessdate=8. april 2019 |language=en}}</ref> Effekten starter normalt etter en time og varer opp til åtte timer.<ref name=Shell2015>{{cite book |last1=Collins |first1=Shelly Rainforth |last2=RN-BC |first2=Shelly Rainforth Collins |title=Pharmacology and the Nursing Process |date=2015 |publisher=Elsevier Health Sciences |isbn=9780323358286 |page=193 |url=https://books.google.ca/books?id=06A_CwAAQBAJ&pg=PA193 |language=en}}</ref>

== Referanser ==
<references />

==Eksterne lenker==
* [https://web.archive.org/web/20080912180825/http://www.rxlist.com/cgi/generic/temaz.htm Temazepam | Rx-List]
* [http://www.inchem.org/documents/pims/pharm/pim683.htm Temazepam | Inchem]
* [https://www.nlm.nih.gov/medlineplus/druginfo/medmaster/a684003.html Temazepam | Medline Plus]
* [http://www.druglib.com/activeingredient/temazepam/ Active Ingredients information | DrugLib] {{Wayback|url=http://www.druglib.com/activeingredient/temazepam/ |date=20121101184810 }}
* [https://www.youtube.com/watch?v=J7Avxapzrh8 Panorama document - 1995 - YouTube video]

[[Kategori:Benzodiazepiner]]